trans-DL-1,2-Cyclopentanedicarboxylic acid CAS No.:1461-97-8
Pharmaceutical Materials 2025-03-03
trans-DL-1,2-Cyclopentanedicarboxylic acid (CPDA) is a colorless crystalline solid with the molecular formula C₇H₁₀O₄ and a molecular weight of 158.15 g/mol. It is widely recognized as a key intermediate in the synthesis of nylon 6,10, a high-performance polymer used in fibers, plastics, and engineering materials. CPDA is also utilized in pharmaceuticals, serving as a precursor for drugs like gliclazide. The compound is typically prepared via oxidation of octanol using cobalt or manganese catalysts. It exhibits high melting point (163–165°C), strong corrosion resistance, and solubility in organic solvents such as DMSO and methanol. Due to its versatility, CPDA plays a critical role in both polymer chemistry and pharmaceutical synthesis.
Usage: Mainly used as Pharmaceutical Intermediates.
Packaging and Shipping: 25KG/drum or as per buyer’s requirements.
Storage: Storage in ventilated low temperature dry warehouse; Keep container closed and separately from open flame and heat source.
| Name | 1,2-cyclopentane dicarboxylic acid |
| Synonyms | 1,2-cyclopentanedicarboxylate 1,2-Cyclopentane DiforMic Acid 1,2-Cyclopentanedicarboxylic acid Cyclopentane-1,2-dicarboxylic acid Transpentane-1,2-dicarboxylic acid 1,2-cyclopentane dicarboxylic acid cyclopentane-1,2-dicarboxylic acid trans-Cyclopentane-1,2-dicarboxylic acid trans-DL-1,2-Cyclopentanedicarboxylic acid TRANS-DL-1,2-CYCLOPENTANEDICARBOXYLIC ACID TRANS-DL-CYCLOPENTANE-1,2-DICARBOXYLIC ACID |
| CAS | 1461-97-8 |
| EINECS | 215-962-9 |
| InChI | InChI=1/C7H10O4/c8-6(9)4-2-1-3-5(4)7(10)11/h4-5H,1-3H2,(H,8,9)(H,10,11)/t4-,5-/m0/s1 |
| Molecular Formula | C7H10O4 |
| Molar Mass | 158.15 |
| Density | 1.396±0.06 g/cm3(Predicted) |
| Melting Point | 163-165°C(lit.) |
| Boling Point | 46-49 °C(Press: 110 Torr) |
| Flash Point | 196.9°C |
| Solubility | DMSO; Methanol |
| Vapor Presure | 8.88E-07mmHg at 25°C |
| Appearance | Solid |
| Color | Off-white |
| pKa | pK1:3.96;pK2:5.85 (25°C) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.535 |
| Use | Used as an intermediate in the drug glistat |
Disclaimer: The above content is for reference and communication only among industry insiders, and does not guarantee its accuracy or completeness. According to relevant laws and regulations and the regulations of this website, units or individuals who purchase related items should obtain valid qualifications and qualification conditions.


