4,4′-oxydiphthalic Anhydride(ODPA) CAS 1823-59-2
Electrolyte Intermediates 2025-03-03
Introduction 4,4 ‘-oxybis-phthalic anhydride is a white to white powder organic substance that can be used to make polyimide resins.
Application 4,4 ‘-oxybis-phthalic anhydride (ODPA) can be used to prepare composite materials, foams, adhesives, molded parts, films, etc.
Chemical properties white to white powder
Uses for composite materials, foams, adhesives, molded parts, films, etc.
Uses are used to make polyimide resins, etc.
| Name | 4.4-Oxydiphthalic anhydride |
| Synonyms | ODPA s-ODPA S-ODPA Oxydiphthalicanhydride 4.4′-Oxydiphthalic Acid 4.4-Oxydiphthalic anhydride 4.4′-Oxydiphthalic anhydride 4.4′-Oxydiphthalic dianhydride Bis-(3-phthalyl anhydride) ether 5.5′-oxybis-3-isobenzofurandione 4.4”-Oxybisdiphthalic anhydride 4-4′-Oxydiphthalic acid anhydride 5.5′-oxybis(2-benzofuran-1.3-dione) |
| CAS | 1823-59-2 |
| EINECS | 412-830-4 |
| InChI | InChI=1/C16H6O7/c17-13-9-3-1-7(5-11(9)15(19)22-13)21-8-2-4-10-12(6-8)16(20)23-14(10)18/h1-6H |
| InChIKey | QQGYZOYWNCKGEK-UHFFFAOYSA-N |
Physico-chemical Properties
| Molecular Formula | C16H6O7 |
| Molar Mass | 310.21 |
| Density | 1.665g/cm3 |
| Melting Point | 225-229℃ |
| Boling Point | 577.7°C at 760 mmHg |
| Flash Point | 260.7°C |
| Vapor Presure | 2.41E-13mmHg at 25°C |
| Appearance | White to white-like powder |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.694 |
| MDL | MFCD00039144 |
| Physical and Chemical Properties | Appearance: white crystalline powder Melting Point: 228-229 |
| Use | For composite materials, foams, adhesives, molded parts, films, etc |
