4-Nitroimidazole CAS No.: 3034-38-6
Pharmaceutical Materials 2025-03-02
4-Nitroimidazole Usage: Mainly used as an intermediate for the anti-protozoal drug ronidazole and as an intermediate for organic synthesis. 4-Nitroimidazole Packaging and Shipping: 25KG/drum or as per buyer requirement. 4-Nitroimidazole Storage: Keep container sealed and store in an ventilated, low temperature, dry warehouse.
| Name | 4-Nitroimidazole |
| Synonyms | NSC 50359 4-Nitroimidazole 5-nitroimidazole 4-Nitro-1H-imidazole The 4-nitroiMidazole 4-NitroiMidazole Solution, 100ppm 4-Nitroimidazole solution,1000ppm Metronidazole IMpurtiy B (4-NitroiMidazole) |
| CAS | 3034-38-6 |
| EINECS | 221-224-7 |
| InChI | InChI=1/C3H3N3O2/c7-6(8)3-1-4-2-5-3/h1-2H,(H,4,5) |
| Molecular Formula | C3H3N3O2 |
| Molar Mass | 113.07 |
| Density | 1.5988 (rough estimate) |
| Melting Point | 303 °C (dec.) (lit.) |
| Boling Point | 211.75°C (rough estimate) |
| Flash Point | 303°C |
| Solubility | 0.40g/l |
| Appearance | Yellow-like crystals |
| Color | White to light yellow |
| BRN | 2815 |
| pKa | 8.31±0.10(Predicted) |
| PH | 7 (0.40g/l, H2O, 20℃) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.4264 (estimate) |
| MDL | MFCD00005196 |
| Physical and Chemical Properties | Melting point 303°C decomposition temperature 303°C |
| Use | Intermediates of the antigenic insect drug Ronidazole. |
,Disclaimer: The above content is for reference and communication only among industry insiders, and does not guarantee its accuracy or completeness. According to relevant laws and regulations and the regulations of this website, units or individuals who purchase related items should obtain valid qualifications and qualification conditions.

