3′-Chloropropiophenone CAS No.: 34841-35-5
Pharmaceutical Materials 2025-03-03
3′-Chloropropiophenone, also known as m-chloropropiophenone or 1-(3-chlorophenyl)propan-1-one, is a key intermediate in organic synthesis with the CAS number 34841-35-5. Its molecular formula is C₉H₉ClO, and it has a molecular weight of 168.62 g/mol. This white crystalline solid exhibits a melting point of 45–47°C and a boiling point of 124°C (14 mmHg), with limited solubility in water. It is widely used in pharmaceutical chemistry for synthesizing antidepressants like bupropion (Wellbutrin) and other bioactive compounds. Its reactivity stems from the electron-withdrawing chlorine atom and the carbonyl group, facilitating nucleophilic addition and substitution reactions. Safety precautions include avoiding exposure to strong oxidizers and using protective equipment during handling due to its irritant properties.
Usage： Mainly usedOrganic synthesis, pharmaceutical synthesis intermediates, can be used for the synthesis of wellbutrin.
Packaging and Shipping： 25KG/drum or as per buyer requirement.
Storage: Keep container sealed and store in an ventilated, low temperature, dry warehouse, separate from foods and oxidizing agents.
| Name | 3′-Chloropropiophenone |
| Synonyms | MCPP M-CHLOROPROPIOPHENONE m-chlorophenylacetone 3′-Chloropropiophenone beta-Chloropropiophenone 3-CHLORO-1-PHENYL-PROPANONE 2-Chloroethyl phenyl ketone 3-CHLOROPHENYL ETHYL KETONE (3-CHLOROPHENYL)PROPAN-1-ONE 3-chloro-1-phenylpropan-1-one 3-Chloro-1-phenyl-1-propanone 1-(3-CHLOROPHENYL)-1-PROPANONE 1-(3-Chlorophenyl)-1-propanone 1-(3-chlorophenyl)propan-1-one 1-(4-chlorophenyl)propan-1-one 3-CHLOROPROPIOPHENONE M-CHLORO PROPIOPHENONE 3-Chloro-Propiophenone(M-ChloroProiophenone) |
| CAS | 34841-35-5 |
| EINECS | 252-242-3 |
| InChI | InChI=1/C9H9ClO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
| InChIKey | PQWGFUFROKIJBO-UHFFFAOYSA-N |
| Molecular Formula | C9H9ClO |
| Molar Mass | 168.62 |
| Density | 1.1115 (rough estimate) |
| Melting Point | 45-47°C(lit.) |
| Boling Point | 124°C14mm Hg(lit.) |
| Flash Point | >230°F |
| Solubility | Soluble in methanol. |
| Vapor Presure | 0.0266mmHg at 25°C |
| Appearance | Bright yellow crystal |
| Color | White to light yellow |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5350 (estimate) |
| MDL | MFCD00009925 |
| Physical and Chemical Properties | Melting point 43-47°C boiling point 124°C (14 torr) |
| Use | For the synthesis of the drug bupropion |
Disclaimer: The above content is for reference and communication only among industry insiders, and does not guarantee its accuracy or completeness. According to relevant laws and regulations and the regulations of this website, units or individuals who purchase related items should obtain valid qualifications and qualification conditions.
