3-Chlorobenzyl chloride CAS 620-20-2
Category：Pharmaceutical Materials
Introduction
3-Chlorobenzyl chloride CAS 620-20-2 Usage： 3-Chlorobenzyl chloride CAS 620-20-2 Used as pesticide, pharmaceutical intermediates 3-Chlorobenzyl chloride CAS 620-20-2 Packaging and Shipping： 200 kg or 25 kg per barrel or as required by buyer. UN 2235 6.1/PG 3 3-Chlorobenzyl chloride CAS 620-20-2 Storage: Store below + 30°C.Storage and transportation according to dangerous chemical
| Name | 3-Chlorobenzyl chloride |
| Synonyms | MCBC AKOS BBS-00004024 A,M-DICHLOROTOLUENE ALPHA,3-DICHLOROTOLUENE 3-CHLOROBENZYL CHLORIDE 3-Chlorobenzyl chloride 3,ALPHA-DICHLOROTOLUENE M-CHLOROBENZYL CHLORIDE m-chlorobenzyl chloride alpha,3-Dichlorotoluene meta chlorobenzyl chloride 1-chloro-3-(chloromethyl)-benzene |
| CAS | 620-20-2 |
| EINECS | 210-629-4 |
| InChI | InChI=1/C7H6Cl2/c8-5-6-2-1-3-7(9)4-6/h1-4H,5H2 |
| Molecular Formula | C7H6Cl2 |
| Molar Mass | 161.03 |
| Density | 1.27 g/mL at 25 °C (lit.) |
| Melting Point | 3.27°C (estimate) |
| Boling Point | 215-216 °C (lit.) |
| Flash Point | 210°F |
| Vapor Presure | 0.236mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Almost colorless |
| BRN | 742266 |
| Sensitive | Lachrymatory |
| Refractive Index | n20/D 1.555(lit.) |
| Physical and Chemical Properties | Colorless or light yellow transparent liquid, boiling point 215-216 ℃, flash point 98 ℃, density 1.27, refractive index 1.5554. |
| Use | Used as pesticide, pharmaceutical intermediates |
,Disclaimer: The above content is for reference and communication only among industry insiders, and does not guarantee its accuracy or completeness. According to relevant laws and regulations and the regulations of this website, units or individuals who purchase related items should obtain valid qualifications and qualification conditions.
