2,4-Difluorobenzonitrile CAS No.:3939-09-1
Pharmaceutical Materials 2025-03-03
2,4-Difluorobenzonitrile (CAS No. 3939-09-1) is a crucial organic compound widely employed in pharmaceuticals, agrochemicals, and specialty chemicals. Its molecular formula is C₇H₃F₂N, with a molecular weight of 139.10 g/mol. This compound serves as a versatile intermediate in synthesizing fluorinated pharmaceuticals, including antifungal and antibacterial agents, due to its reactive nitrile and fluorine groups. Its stability under normal conditions and compatibility with various solvents make it suitable for industrial-scale production. Additionally, 2,4-difluorobenzonitrile is utilized in the development of liquid crystals and advanced materials, leveraging its unique electronic properties. The compound’s well-documented physical and chemical properties, including melting point, boiling point, and solubility, ensure its reliability in research and manufacturing processes.
Usage: Used as pharmaceutical intermediate and Pesticide intermediate.
Packaging and Shipping: 25KG/drum.
Storage: Keep container sealed and store in an ventilated, low temperature, dry warehouse, separate from foods and oxidizing agents.
| Name | 2,4-Difluorobenzonitrile |
| Synonyms | NCR BF DF 2-difluorobenzotrile 2,4-difluorobenzonilyile 2,4-Difluorobenzonitrile 2,4-DIFLUOROBENZONITRILE 2,4-Difluorobenzenecarbonitrile |
| CAS | 3939-09-1 103496-86-2 |
| EINECS | 223-523-8 |
| InChI | InChI=1/C7H3F2N/c8-6-2-1-5(4-10)7(9)3-6/h1-3H |
| Molecular Formula | C7H3F2N |
| Molar Mass | 139.1 |
| Density | 1.246 |
| Melting Point | 47-49 °C (lit.) |
| Boling Point | 189°C |
| Flash Point | >230°F |
| Solubility | soluble in Methanol |
| Vapor Presure | 0.845mmHg at 25°C |
| Appearance | Crystalline |
| Color | White to Almost white |
| BRN | 1940316 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.486 |
| Physical and Chemical Properties | Melting point 45-50°C |
| Use | Used as a pharmaceutical Intermediate |
Disclaimer: The above content is for reference and communication only among industry insiders, and does not guarantee its accuracy or completeness. According to relevant laws and regulations and the regulations of this website, units or individuals who purchase related items should obtain valid qualifications and qualification conditions.


