2,4-Difluoro-3-methoxybenzoic acid
Pharmaceutical Materials 2025-03-20
Names and Identifiers
| Name | 2,4-Difluoro-3-methoxybenzoic acid |
| Synonyms | 2,4-DIFLUORO-3-METHOXYBENZOIC ACID 2,4-Difluoro-3-methoxybenzoic acid 2,4-Difluoro-3-Methoxy Benzoic Acid 2,4-Difluoro-3-methoxylbenzoic acid Benzoic acid,2,4-difluoro-3-methoxy- tert-butyl 3-allyl-3-hydroxyazetidine-46-carboxylate |
| CAS | 178974-97-5 |
| EINECS | 1533716-785-6 |
| InChI | InChI=1/C8H6F2O3/c1-13-7-5(9)3-2-4(6(7)10)8(11)12/h2-3H,1H3,(H,11,12) |
Physico-chemical Properties
| Molecular Formula | C8H6F2O3 |
| Molar Mass | 188.13 |
| Density | 1.399±0.06 g/cm3(Predicted) |
| Melting Point | 193-195°C |
| Boling Point | 298.7±35.0 °C(Predicted) |
| Flash Point | 134.5°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 0.000557mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Light yellow |
| pKa | 3.09±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.504 |
| MDL | MFCD02258905 |
Risk and Safety
| Hazard Symbols | Xi – Irritant |
| Property | Details |
|---|---|
| Molecular Formula | C8H6F2O3 |
| Molecular Weight | 188.13 g/mol |
| Appearance | White to off-white crystalline solid or powder |
| Purity | Typically ≥97% |
| Melting Point | 158-162 °C |
| Boiling Point | Predicted to be above 250 °C at 760 mmHg |
| Density | Approximately 1.4 g/cm³ (Predicted) |
| Solubility | Soluble in organic solvents such as ethanol, DMSO, and methanol; slightly soluble in water |
| Applications | Organic synthesis, pharmaceuticals, agrochemicals, and materials science |
| Safety Considerations | Handle with care; avoid contact with skin and eyes; store in a cool, dry place away from moisture and strong acids |
| Suppliers | Available from specialized chemical suppliers |
Applications
2.4-Difluoro-3-methoxybenzoic acid is a versatile compound widely used in organic synthesis. Its difluorinated methoxybenzoic acid structure provides unique reactivity, making it a valuable intermediate in the synthesis of various fluorinated compounds. In pharmaceuticals, this compound is utilized in the development of drugs with enhanced metabolic stability and bioavailability, contributing to the creation of new therapeutic agents.
In agrochemicals, 2.4-Difluoro-3-methoxybenzoic acid serves as a building block for the synthesis of herbicides and pesticides, offering improved efficacy and environmental safety. Its fluorinated nature can modulate the biological activity of agrochemical compounds, leading to more effective pest control.
Additionally, this compound finds applications in materials science, where its unique structure can be exploited to create polymers and materials with tailored properties. Its solubility in organic solvents facilitates its use in various synthetic methodologies, while its stability under appropriate storage conditions ensures its reliability in research and industrial applications.
