2-Fluorophenol CAS No.:367-12-4
2-Fluorophenol Usage： Used as pharmaceutical intermediate and other organic synthetic intermediates 2-Fluorophenol Packaging and Shipping： 25kg/ drum or as per buyer requirement. 2-Fluorophenol S...
Category：Pharmaceutical Materials
Introduction
2-Fluorophenol Usage： Used as pharmaceutical intermediate and other organic synthetic intermediates 2-Fluorophenol Packaging and Shipping： 25kg/ drum or as per buyer requirement. 2-Fluorophenol Storage: Ventilated and dry; separate from alkalis, oxidisers, organic materials and flammable materials
| Name | 2-Fluorophenol |
| Synonyms | 2-Florophenol 2-fluoro-pheno 2-Fluorophenol 2-FLUOROPHENOL 2-Hydroxyfluorobenzene 2-FLUOROHYDROXYBENZENE Adjacent fluorine phenol 1-Fluoro-2-hydroxybenzene Fluorophenolmincolorlessliq |
| CAS | 367-12-4 |
| EINECS | 206-681-2 |
| InChI | InChI=1/C6H5FO/c7-5-3-1-2-4-6(5)8/h1-4,8H |
| InChIKey | HFHFGHLXUCOHLN-UHFFFAOYSA-N |
| Molecular Formula | C6H5FO |
| Molar Mass | 112.1 |
| Density | 1.256 g/mL at 25 °C (lit.) |
| Melting Point | 16.1 °C (lit.) |
| Boling Point | 171-172 °C/741 mmHg (lit.) |
| Flash Point | 116°F |
| Water Solubility | 80.72g/L(25 ºC) |
| Solubility | 37.7g/l |
| Vapor Presure | 2.86mmHg at 25°C |
| Appearance | Transparent liquid |
| Specific Gravity | 1.256 |
| Color | Clear colorless to light yellow-brownish |
| BRN | 1905112 |
| pKa | 8.73(at 25℃) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Stability | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Refractive Index | n20/D 1.511(lit.) |
| MDL | MFCD00002155 |
| Physical and Chemical Properties | Colorless transparent liquid, melting point 16.1 ℃, boiling point 171-172 ℃/741mmHg, Flash Point 46 ℃, specific gravity 1.256, refractive index 1.5140. |
| Use | Used as pesticide, pharmaceutical and dye intermediates |
,Disclaimer: The above content is for reference and communication only among industry insiders, and does not guarantee its accuracy or completeness. According to relevant laws and regulations and the regulations of this website, units or individuals who purchase related items should obtain valid qualifications and qualification conditions.
![3-[[[2-[[(4-Cyanophenyl)amino]methyl]-1-methyl-1H-benzimidazol-5-yl]carbonyl]pyridin-2-ylamino]propionic acid ethyl ester](https://moutainchem.com/wp-content/themes/wp1a24tradexhrfb-jixie/images/noneimg-product.jpg
)
