2-Bromo-4-fluoroaniline CAS No.:1003-98-1
Pharmaceutical Materials 2025-03-02
2-Bromo-4-fluoroaniline is a crucial intermediate in organic synthesis, particularly in pharmaceuticals and agrochemicals. Its structure combines a bromine atom and a fluorine atom on an aromatic amine, providing unique reactivity for nucleophilic substitution, coupling reactions, and C–N bond formation. This compound is widely used in the synthesis of fluorinated drugs, herbicides, and specialty chemicals due to its ability to introduce fluorine and bromine functionalities, which enhance metabolic stability and bioavailability. Additionally, it serves as a building block for advanced materials and dyes. Its applications span industries from medicine to materials science, leveraging its reactivity and stability under various reaction conditions.
Usage: Used as pharmaceutical intermediates and organic synthesis intermediates
Packaging and Shipping: 25KG/drum or as per buyer’s requirements
Storage: Storage in ventilated low temperature dry warehouse; Keep container closed and separately from open flame and heat source.
| Name | 2-bromo-4-fluoroaniline |
| Synonyms | Bromofluoroaniline1 2-Bromo-4-fluoroanil 2-BROMO-4-FLUOROANILINE 2-bromo-4-fluoroaniline 4-FLUORO-2-BROMOANILINE 2-BROMO-4-FLUORO-PHENYLAMINE Benzenamine, 2-bromo-4-fluoro- |
| CAS | 1003-98-1 |
| EINECS | 619-469-3 |
| InChI | InChI=1/C6H5BrFN/c7-5-2-1-4(8)3-6(5)9/h1-3H,9H2 |
| InChIKey | YLMFXCIATJJKQL-UHFFFAOYSA-N |
| Molecular Formula | C6H5BrFN |
| Molar Mass | 190.01 |
| Density | 1.67 g/mL at 25 °C (lit.) |
| Melting Point | 41 |
| Boling Point | 221 °C (lit.) |
| Flash Point | 220°F |
| Vapor Presure | 0.0743mmHg at 25°C |
| Appearance | Liquid |
| Specific Gravity | 1.670 |
| Color | Clear yellow-brown |
| BRN | 2802562 |
| pKa | 2.60±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | n20/D 1.583(lit.) |
| Physical and Chemical Properties | Light yellow oily liquid |
,Disclaimer: The above content is for reference and communication only among industry insiders, and does not guarantee its accuracy or completeness. According to relevant laws and regulations and the regulations of this website, units or individuals who purchase related items should obtain valid qualifications and qualification conditions.


