1-Bromo-3,5-difluorobenzene CAS 461-96-1
Pharmaceutical Materials 2025-03-02
1-Bromo-3,5-difluorobenzene Usage: Used as intermediates in medicine or liquid crystal materials 1-Bromo-3,5-difluorobenzene Packaging and Shipping: 1000KG/IBC drum; 200KG/drum or as per buyer requirment 1-Bromo-3,5-difluorobenzene Storage: in a dry and ventilated warehouse; keep away from sunshine; avoid fire; avoid moisture.
| Name | 1-Bromo-3,5-difluorobenzene |
| Synonyms | 3,5-Difluorobromobenzene 3,5-DIFLUOROBROMOBENZENE 1-Brom-3,5-difluorbenzol 3,5-Difluoro bromobenzene 1-BROMO-3,5-DIFLUOROBENZENE 1-Bromo-3,5-difluorobenzene 3,5-difluoro-1-bromobenzene 1-bromo-3,5-difluoro-benzene 1-Bromo-3,5-Difluoro Benzene |
| CAS | 461-96-1 |
| EINECS | 416-710-2 |
| InChI | InChI=1/C6H3BrF2/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| InChIKey | JHLKSIOJYMGSMB-UHFFFAOYSA-N |
| Molecular Formula | C6H3BrF2 |
| Molar Mass | 192.99 |
| Density | 1.676 g/mL at 25 °C (lit.) |
| Melting Point | -27 °C |
| Boling Point | 140 °C (lit.) |
| Flash Point | 112°F |
| Water Solubility | 0.238 g/L (20 ºC) |
| Solubility | 0.238g/l |
| Vapor Presure | 7.81mmHg at 25°C |
| Appearance | Liquid |
| Specific Gravity | 1.686 |
| Color | Clear colorless to light yellow |
| BRN | 1931520 |
| PH | 6.6 (0.238g/l, H2O, 20℃) |
| Storage Condition | Sealed in dry,2-8°C |
| Refractive Index | n20/D 1.499(lit.) |
| Physical and Chemical Properties | Density 1.676 melting point -27°C boiling point 140°C refractive index 1.498-1.5 flash point 45°C water-soluble 0.238g/L (20°C) |
| Use | For pharmaceutical or liquid crystal material intermediates |
,Disclaimer: The above content is for reference and communication only among industry insiders, and does not guarantee its accuracy or completeness. According to relevant laws and regulations and the regulations of this website, units or individuals who purchase related items should obtain valid qualifications and qualification conditions.


