1-Bromo-2,4,6-trifluorobenzene CAS 2367-76-2
Pharmaceutical Materials 2025-03-03
1-Bromo-2,4,6-Trifluorobenzene is a key fluorinated aromatic compound with the molecular formula C₆H₂BrF₃ and a molecular weight of 210.98 g/mol. It is widely used as an intermediate in pharmaceuticals, agrochemicals, and liquid crystal materials. Its synthesis typically involves bromination of 2,4,6-trifluorobenzene or fluorination-bromination of substituted benzene derivatives. The compound exhibits a melting point of 3.5°C, a boiling point of 135.8–140.5°C, and a density of 1.79 g/cm³. Due to its reactivity and stability, it serves as a precursor for fluorinated drugs, herbicides, and advanced materials. Proper handling and storage in sealed, cool, and dry conditions are essential to prevent degradation and ensure safety.
Usage： 1-Bromo-2,4,6-trifluorobenzene are mainly used as pharmaceutical intermediates. For organic synthesis.
Packaging and Shipping： 25kgs/Bag or Drum or as required by buyer.
Storage: Warehouse ventilation and low temperature drying; Store separately from nitric acid and sulfuric acid
| Name | 1-bromo-2,4,6-trifluorobenzene |
| Synonyms | 2,4,6-Trifluorovbromobenzene 2,4,6-Trifluorophenyl bromide 1-Bromo-2,4,6-trifluorobezene 1,3,5-Trifluoro-2-bromobenzene 2-bromo-1,3,5-trifluorobenzene 2,4,6-Trifluoro-1-bromobenzene 1-bromo-2,4,6-trifluorobenzene 1-Bromo-2,4,6-Trifluoro Benzene 1,3-dichloro-2,5-difluorobenzene Benzene, 2-bromo-1,3,5-trifluoro- |
| CAS | 2367-76-2 |
| EINECS | 219-125-9 |
| InChI | InChI=1/C6H2Cl2F2/c7-4-1-3(9)2-5(8)6(4)10/h1-2H |
| Molecular Formula | C6H2BrF3 |
| Molar Mass | 210.98 |
| Density | 1.79 g/mL at 25 °C (lit.) |
| Melting Point | 3.5 °C (lit.) |
| Boling Point | 140.5 °C (lit.) |
| Flash Point | 137°F |
| Solubility | Chloroform, Ethyl Acetate |
| Vapor Presure | 1.7mmHg at 25°C |
| Appearance | Oil |
| Specific Gravity | 1.80 |
| Color | Clear Colourless to Light Yellow |
| BRN | 2502668 |
| Storage Condition | Sealed in dry,2-8°C |
| Refractive Index | n20/D 1.485(lit.) |
| Physical and Chemical Properties | Boiling point 140.5 ℃, melting point 3.5 ℃, flash point> 110 ℃, refractive index 1.4850, specific gravity 1.790. |
Disclaimer: The above content is for reference and communication only among industry insiders, and does not guarantee its accuracy or completeness. According to relevant laws and regulations and the regulations of this website, units or individuals who purchase related items should obtain valid qualifications and qualification conditions.
